C21H31NO6S — CID 67554682
tert-butyl 4-[4-[(3-methylazetidin-3-yl)methoxy]phenyl]sulfonyloxane-4-carboxylate (PubChem CID 67554682) has the molecular formula C21H31NO6S and a molecular weight of 425.55 g/mol. Its IUPAC name is tert-butyl 4-[4-[(3-methylazetidin-3-yl)methoxy]phenyl]sulfonyloxane-4-carboxylate.
| Compound Name | tert-butyl 4-[4-[(3-methylazetidin-3-yl)methoxy]phenyl]sulfonyloxane-4-carboxylate |
|---|---|
| PubChem CID | 67554682 |
| Molecular Formula | C21H31NO6S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | tert-butyl 4-[4-[(3-methylazetidin-3-yl)methoxy]phenyl]sulfonyloxane-4-carboxylate |
| SMILES | CC1(COc2ccc(S(=O)(=O)C3(C(=O)OC(C)(C)C)CCOCC3)cc2)CNC1 |
| InChI | InChI=1S/C21H31NO6S/c1-19(2,3)28-18(23)21(9-11-26-12-10-21)29(24,25)17-7-5-16(6-8-17)27-15-20(4)13-22-14-20/h5-8,22H,9-15H2,1-4H3 |
| InChIKey | REZQACFBFZEFEF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |