C24H31NO8S2 — CID 20620661
4-[4-(3-benzylsulfonyl-2,2-dimethylpropoxy)phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20620661) has the molecular formula C24H31NO8S2 and a molecular weight of 525.65 g/mol. Its IUPAC name is 4-[4-(3-benzylsulfonyl-2,2-dimethylpropoxy)phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-(3-benzylsulfonyl-2,2-dimethylpropoxy)phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20620661 |
| Molecular Formula | C24H31NO8S2 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 4-[4-(3-benzylsulfonyl-2,2-dimethylpropoxy)phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | CC(C)(COc1ccc(S(=O)(=O)C2(C(=O)NO)CCOCC2)cc1)CS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H31NO8S2/c1-23(2,18-34(28,29)16-19-6-4-3-5-7-19)17-33-20-8-10-21(11-9-20)35(30,31)24(22(26)25-27)12-14-32-15-13-24/h3-11,27H,12-18H2,1-2H3,(H,25,26) |
| InChIKey | VLBNGUYZWQJCRI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|