C18H25NO7S — CID 120543312
4-[[4-(4-methylsulfonylphenoxy)butanoylamino]methyl]oxane-4-carboxylic acid (PubChem CID 120543312) has the molecular formula C18H25NO7S and a molecular weight of 399.47 g/mol. Its IUPAC name is 4-[[4-(4-methylsulfonylphenoxy)butanoylamino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[4-(4-methylsulfonylphenoxy)butanoylamino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120543312 |
| Molecular Formula | C18H25NO7S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 4-[[4-(4-methylsulfonylphenoxy)butanoylamino]methyl]oxane-4-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc(OCCCC(=O)NCC2(C(=O)O)CCOCC2)cc1 |
| InChI | InChI=1S/C18H25NO7S/c1-27(23,24)15-6-4-14(5-7-15)26-10-2-3-16(20)19-13-18(17(21)22)8-11-25-12-9-18/h4-7H,2-3,8-13H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | QUEDREQXABINJY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|