C22H26N2O7S — CID 118179844
N-hydroxy-3-[4-(4-methoxyphenoxy)phenyl]sulfonyl-1-oxa-8-azaspiro[4.5]decane-3-carboxamide (PubChem CID 118179844) has the molecular formula C22H26N2O7S and a molecular weight of 462.52 g/mol. Its IUPAC name is N-hydroxy-3-[4-(4-methoxyphenoxy)phenyl]sulfonyl-1-oxa-8-azaspiro[4.5]decane-3-carboxamide.
| Compound Name | N-hydroxy-3-[4-(4-methoxyphenoxy)phenyl]sulfonyl-1-oxa-8-azaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 118179844 |
| Molecular Formula | C22H26N2O7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-hydroxy-3-[4-(4-methoxyphenoxy)phenyl]sulfonyl-1-oxa-8-azaspiro[4.5]decane-3-carboxamide |
| SMILES | COc1ccc(Oc2ccc(S(=O)(=O)C3(C(=O)NO)COC4(CCNCC4)C3)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O7S/c1-29-16-2-4-17(5-3-16)31-18-6-8-19(9-7-18)32(27,28)22(20(25)24-26)14-21(30-15-22)10-12-23-13-11-21/h2-9,23,26H,10-15H2,1H3,(H,24,25) |
| InChIKey | HMGDOXOJJSGFFB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|