C22H27N3O6S — CID 118179843
N-hydroxy-3-[4-(4-methoxyphenoxy)phenyl]sulfonyl-2,8-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 118179843) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is N-hydroxy-3-[4-(4-methoxyphenoxy)phenyl]sulfonyl-2,8-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | N-hydroxy-3-[4-(4-methoxyphenoxy)phenyl]sulfonyl-2,8-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 118179843 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | N-hydroxy-3-[4-(4-methoxyphenoxy)phenyl]sulfonyl-2,8-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | COc1ccc(Oc2ccc(S(=O)(=O)C3(C(=O)NO)CC4(CCNCC4)CN3)cc2)cc1 |
| InChI | InChI=1S/C22H27N3O6S/c1-30-16-2-4-17(5-3-16)31-18-6-8-19(9-7-18)32(28,29)22(20(26)25-27)14-21(15-24-22)10-12-23-13-11-21/h2-9,23-24,27H,10-15H2,1H3,(H,25,26) |
| InChIKey | XHPHKZWPYIMZGW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|