C24H24N2O5S — CID 20683088
(2R)-N-hydroxy-2-[4-(4-phenylphenoxy)phenyl]sulfonylpiperidine-2-carboxamide (PubChem CID 20683088) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is (2R)-N-hydroxy-2-[4-(4-phenylphenoxy)phenyl]sulfonylpiperidine-2-carboxamide.
| Compound Name | (2R)-N-hydroxy-2-[4-(4-phenylphenoxy)phenyl]sulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 20683088 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (2R)-N-hydroxy-2-[4-(4-phenylphenoxy)phenyl]sulfonylpiperidine-2-carboxamide |
| SMILES | O=C(NO)[C@]1(S(=O)(=O)c2ccc(Oc3ccc(-c4ccccc4)cc3)cc2)CCCCN1 |
| InChI | InChI=1S/C24H24N2O5S/c27-23(26-28)24(16-4-5-17-25-24)32(29,30)22-14-12-21(13-15-22)31-20-10-8-19(9-11-20)18-6-2-1-3-7-18/h1-3,6-15,25,28H,4-5,16-17H2,(H,26,27)/t24-/m1/s1 |
| InChIKey | SDCPBDOMTBRRBS-XMMPIXPASA-N |
| XLogP | 3.89 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|