C19H21ClF2N2O5S2 — CID 158016230
4-[4-[4-(difluoromethylsulfanyl)phenoxy]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide;hydrochloride (PubChem CID 158016230) has the molecular formula C19H21ClF2N2O5S2 and a molecular weight of 494.97 g/mol. Its IUPAC name is 4-[4-[4-(difluoromethylsulfanyl)phenoxy]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-[4-[4-(difluoromethylsulfanyl)phenoxy]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 158016230 |
| Molecular Formula | C19H21ClF2N2O5S2 |
| Molecular Weight | 494.97 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | 4-[4-[4-(difluoromethylsulfanyl)phenoxy]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NO)C1(S(=O)(=O)c2ccc(Oc3ccc(SC(F)F)cc3)cc2)CCNCC1 |
| InChI | InChI=1S/C19H20F2N2O5S2.ClH/c20-18(21)29-15-5-1-13(2-6-15)28-14-3-7-16(8-4-14)30(26,27)19(17(24)23-25)9-11-22-12-10-19;/h1-8,18,22,25H,9-12H2,(H,23,24);1H |
| InChIKey | OOPHTIFEMWGEDC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.97 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|