C23H28N2O7S — CID 22985992
tert-butyl 4-(hydroxycarbamoyl)-4-(3-phenoxyphenyl)sulfonylpiperidine-1-carboxylate (PubChem CID 22985992) has the molecular formula C23H28N2O7S and a molecular weight of 476.55 g/mol. Its IUPAC name is tert-butyl 4-(hydroxycarbamoyl)-4-(3-phenoxyphenyl)sulfonylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(hydroxycarbamoyl)-4-(3-phenoxyphenyl)sulfonylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 22985992 |
| Molecular Formula | C23H28N2O7S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | tert-butyl 4-(hydroxycarbamoyl)-4-(3-phenoxyphenyl)sulfonylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NO)(S(=O)(=O)c2cccc(Oc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C23H28N2O7S/c1-22(2,3)32-21(27)25-14-12-23(13-15-25,20(26)24-28)33(29,30)19-11-7-10-18(16-19)31-17-8-5-4-6-9-17/h4-11,16,28H,12-15H2,1-3H3,(H,24,26) |
| InChIKey | UZLJHVBFFGRBQT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|