C23H30N2O4S — CID 131653378
2-(4-methoxyphenyl)sulfonyl-9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decane (PubChem CID 131653378) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)sulfonyl-9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decane.
| Compound Name | 2-(4-methoxyphenyl)sulfonyl-9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 131653378 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-(4-methoxyphenyl)sulfonyl-9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decane |
| SMILES | COc1ccc(S(=O)(=O)N2CCC3(CCCN(CCOc4ccccc4)C3)C2)cc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-28-20-8-10-22(11-9-20)30(26,27)25-15-13-23(19-25)12-5-14-24(18-23)16-17-29-21-6-3-2-4-7-21/h2-4,6-11H,5,12-19H2,1H3 |
| InChIKey | JQFOPZJNRARERL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |