C20H27N2O4S+ — CID 9036549
1-(4-methoxyphenyl)sulfonyl-4-(3-phenoxypropyl)piperazin-4-ium (PubChem CID 9036549) has the molecular formula C20H27N2O4S+ and a molecular weight of 391.51 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonyl-4-(3-phenoxypropyl)piperazin-4-ium.
| Compound Name | 1-(4-methoxyphenyl)sulfonyl-4-(3-phenoxypropyl)piperazin-4-ium |
|---|---|
| PubChem CID | 9036549 |
| Molecular Formula | C20H27N2O4S+ |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonyl-4-(3-phenoxypropyl)piperazin-4-ium |
| SMILES | COc1ccc(S(=O)(=O)N2CC[NH+](CCCOc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H26N2O4S/c1-25-18-8-10-20(11-9-18)27(23,24)22-15-13-21(14-16-22)12-5-17-26-19-6-3-2-4-7-19/h2-4,6-11H,5,12-17H2,1H3/p+1 |
| InChIKey | GQIOXVUXQLRODF-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|