C21H27N2O3S+ — CID 9257795
1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-(2-phenoxyethyl)piperazin-4-ium (PubChem CID 9257795) has the molecular formula C21H27N2O3S+ and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-(2-phenoxyethyl)piperazin-4-ium.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-(2-phenoxyethyl)piperazin-4-ium |
|---|---|
| PubChem CID | 9257795 |
| Molecular Formula | C21H27N2O3S+ |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-(2-phenoxyethyl)piperazin-4-ium |
| SMILES | O=S(=O)(c1ccc2c(c1)CCC2)N1CC[NH+](CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N2O3S/c24-27(25,21-10-9-18-5-4-6-19(18)17-21)23-13-11-22(12-14-23)15-16-26-20-7-2-1-3-8-20/h1-3,7-10,17H,4-6,11-16H2/p+1 |
| InChIKey | NRRBZAXRRDZABZ-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |