C20H26ClN2O4S+ — CID 8693896
1-(2-chlorophenyl)sulfonyl-4-[3-(4-methoxyphenoxy)propyl]piperazin-4-ium (PubChem CID 8693896) has the molecular formula C20H26ClN2O4S+ and a molecular weight of 425.96 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-4-[3-(4-methoxyphenoxy)propyl]piperazin-4-ium.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-4-[3-(4-methoxyphenoxy)propyl]piperazin-4-ium |
|---|---|
| PubChem CID | 8693896 |
| Molecular Formula | C20H26ClN2O4S+ |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-4-[3-(4-methoxyphenoxy)propyl]piperazin-4-ium |
| SMILES | COc1ccc(OCCC[NH+]2CCN(S(=O)(=O)c3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H25ClN2O4S/c1-26-17-7-9-18(10-8-17)27-16-4-11-22-12-14-23(15-13-22)28(24,25)20-6-3-2-5-19(20)21/h2-3,5-10H,4,11-16H2,1H3/p+1 |
| InChIKey | RILGDYIYRQJPJX-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|