C15H20N4O3 — CID 168747424
3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-6-methyl-1,2,4,5-tetrazine (PubChem CID 168747424) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-6-methyl-1,2,4,5-tetrazine.
| Compound Name | 3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-6-methyl-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 168747424 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-6-methyl-1,2,4,5-tetrazine |
| SMILES | CCOCCOCCOc1ccc(-c2nnc(C)nn2)cc1 |
| InChI | InChI=1S/C15H20N4O3/c1-3-20-8-9-21-10-11-22-14-6-4-13(5-7-14)15-18-16-12(2)17-19-15/h4-7H,3,8-11H2,1-2H3 |
| InChIKey | PZHYVPPECUNXRO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 79.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|