C20H29N5O6 — CID 177255727
2-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide (PubChem CID 177255727) has the molecular formula C20H29N5O6 and a molecular weight of 435.48 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide.
| Compound Name | 2-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 177255727 |
| Molecular Formula | C20H29N5O6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 2-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
| SMILES | Cc1nnc(-c2ccc(OCCOCCOCCOCCOC(C)C(N)=O)cc2)nn1 |
| InChI | InChI=1S/C20H29N5O6/c1-15(19(21)26)30-13-11-28-9-7-27-8-10-29-12-14-31-18-5-3-17(4-6-18)20-24-22-16(2)23-25-20/h3-6,15H,7-14H2,1-2H3,(H2,21,26) |
| InChIKey | FRSDLRKSVJYDED-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 140.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|