C25H33N5O8 — CID 176817123
N-(2,5-dioxocyclopentyl)-3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide (PubChem CID 176817123) has the molecular formula C25H33N5O8 and a molecular weight of 531.57 g/mol. Its IUPAC name is N-(2,5-dioxocyclopentyl)-3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide.
| Compound Name | N-(2,5-dioxocyclopentyl)-3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 176817123 |
| Molecular Formula | C25H33N5O8 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | N-(2,5-dioxocyclopentyl)-3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
| SMILES | Cc1nnc(-c2ccc(OCCOCCOCCOCCOCCC(=O)NC3C(=O)CCC3=O)cc2)nn1 |
| InChI | InChI=1S/C25H33N5O8/c1-18-27-29-25(30-28-18)19-2-4-20(5-3-19)38-17-16-37-15-14-36-13-12-35-11-10-34-9-8-23(33)26-24-21(31)6-7-22(24)32/h2-5,24H,6-17H2,1H3,(H,26,33) |
| InChIKey | VPDRYIZHMSGNEA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 160.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|