C33H38F3IO3S — CID 159324580
bis(tert-butylbenzene);diphenyliodanium;trifluoromethanesulfonate (PubChem CID 159324580) has the molecular formula C33H38F3IO3S and a molecular weight of 698.63 g/mol. Its IUPAC name is bis(tert-butylbenzene);diphenyliodanium;trifluoromethanesulfonate.
| Compound Name | bis(tert-butylbenzene);diphenyliodanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159324580 |
| Molecular Formula | C33H38F3IO3S |
| Molecular Weight | 698.63 g/mol |
| Exact Mass | 698.15 |
| IUPAC Name | bis(tert-butylbenzene);diphenyliodanium;trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1ccccc1.CC(C)(C)c1ccccc1.O=S(=O)([O-])C(F)(F)F.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10I.2C10H14.CHF3O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2*1-10(2,3)9-7-5-4-6-8-9;2-1(3,4)8(5,6)7/h1-10H;2*4-8H,1-3H3;(H,5,6,7)/q+1;;;/p-1 |
| InChIKey | LEERVZHRYZGRQB-UHFFFAOYSA-M |
| XLogP | 5.83 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|