C24H22O4S2 — CID 125034103
(1R,2S,3R,4S,6S,7R,8R,9S,10R,11S)-10,11-bis(benzenesulfonyl)hexacyclo[7.2.1.02,4.02,8.03,7.06,8]dodecane (PubChem CID 125034103) has the molecular formula C24H22O4S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is (1R,2S,3R,4S,6S,7R,8R,9S,10R,11S)-10,11-bis(benzenesulfonyl)hexacyclo[7.2.1.02,4.02,8.03,7.06,8]dodecane.
| Compound Name | (1R,2S,3R,4S,6S,7R,8R,9S,10R,11S)-10,11-bis(benzenesulfonyl)hexacyclo[7.2.1.02,4.02,8.03,7.06,8]dodecane |
|---|---|
| PubChem CID | 125034103 |
| Molecular Formula | C24H22O4S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | (1R,2S,3R,4S,6S,7R,8R,9S,10R,11S)-10,11-bis(benzenesulfonyl)hexacyclo[7.2.1.02,4.02,8.03,7.06,8]dodecane |
| SMILES | O=S(=O)(c1ccccc1)[C@@H]1[C@H](S(=O)(=O)c2ccccc2)[C@H]2C[C@@H]1[C@]13C4CC5[C@H]([C@@H]41)[C@]523 |
| InChI | InChI=1S/C24H22O4S2/c25-29(26,13-7-3-1-4-8-13)21-17-12-18(22(21)30(27,28)14-9-5-2-6-10-14)24-16-11-15-19(20(16)24)23(15,17)24/h1-10,15-22H,11-12H2/t15?,16?,17-,18+,19-,20-,21-,22+,23+,24-/m1/s1 |
| InChIKey | HGKSRZHCCKJCCV-KMQATYNSSA-N |
| XLogP | 3.20 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |