C30H27N3O4S2 — CID 125036725
(1S,2R,5R,6S,7R,8S,9R,10S)-8,9-bis(benzenesulfonyl)-13-phenyl-11,12,13-triazapentacyclo[4.4.3.12,5.17,10.01,6]pentadeca-3,11-diene (PubChem CID 125036725) has the molecular formula C30H27N3O4S2 and a molecular weight of 557.70 g/mol. Its IUPAC name is (1S,2R,5R,6S,7R,8S,9R,10S)-8,9-bis(benzenesulfonyl)-13-phenyl-11,12,13-triazapentacyclo[4.4.3.12,5.17,10.01,6]pentadeca-3,11-diene.
| Compound Name | (1S,2R,5R,6S,7R,8S,9R,10S)-8,9-bis(benzenesulfonyl)-13-phenyl-11,12,13-triazapentacyclo[4.4.3.12,5.17,10.01,6]pentadeca-3,11-diene |
|---|---|
| PubChem CID | 125036725 |
| Molecular Formula | C30H27N3O4S2 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | (1S,2R,5R,6S,7R,8S,9R,10S)-8,9-bis(benzenesulfonyl)-13-phenyl-11,12,13-triazapentacyclo[4.4.3.12,5.17,10.01,6]pentadeca-3,11-diene |
| SMILES | O=S(=O)(c1ccccc1)[C@@H]1[C@H](S(=O)(=O)c2ccccc2)[C@H]2C[C@@H]1[C@@]13[C@H]4C=C[C@@H](C4)[C@]21N=NN3c1ccccc1 |
| InChI | InChI=1S/C30H27N3O4S2/c34-38(35,23-12-6-2-7-13-23)27-25-19-26(28(27)39(36,37)24-14-8-3-9-15-24)30-21-17-16-20(18-21)29(25,30)31-32-33(30)22-10-4-1-5-11-22/h1-17,20-21,25-28H,18-19H2/t20-,21-,25+,26-,27+,28-,29-,30-/m0/s1 |
| InChIKey | YJNOMARBDSJKLG-VPGVXAIKSA-N |
| XLogP | 4.89 |
| TPSA | 96.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|