C20H20O4S — CID 125034659
methyl (1R,2S,3R,4S,6S,7R,8S,9R,10S,11S)-11-(benzenesulfonyl)hexacyclo[7.2.1.02,4.02,8.03,7.06,8]dodecane-10-carboxylate (PubChem CID 125034659) has the molecular formula C20H20O4S and a molecular weight of 356.44 g/mol. Its IUPAC name is methyl (1R,2S,3R,4S,6S,7R,8S,9R,10S,11S)-11-(benzenesulfonyl)hexacyclo[7.2.1.02,4.02,8.03,7.06,8]dodecane-10-carboxylate.
| Compound Name | methyl (1R,2S,3R,4S,6S,7R,8S,9R,10S,11S)-11-(benzenesulfonyl)hexacyclo[7.2.1.02,4.02,8.03,7.06,8]dodecane-10-carboxylate |
|---|---|
| PubChem CID | 125034659 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | methyl (1R,2S,3R,4S,6S,7R,8S,9R,10S,11S)-11-(benzenesulfonyl)hexacyclo[7.2.1.02,4.02,8.03,7.06,8]dodecane-10-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](S(=O)(=O)c2ccccc2)[C@@H]2C[C@H]1[C@@]13C4CC5[C@H]([C@@H]41)[C@@]523 |
| InChI | InChI=1S/C20H20O4S/c1-24-18(21)14-10-7-13(17(14)25(22,23)9-5-3-2-4-6-9)20-12-8-11-15(16(12)20)19(10,11)20/h2-6,10-17H,7-8H2,1H3/t10-,11?,12?,13+,14-,15-,16-,17+,19-,20-/m1/s1 |
| InChIKey | KWYOXMNCLJUIDK-CVMWAPDUSA-N |
| XLogP | 2.15 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |