C13H14O4S — CID 14108399
methyl 3-(benzenesulfonyl)cyclopent-3-ene-1-carboxylate (PubChem CID 14108399) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is methyl 3-(benzenesulfonyl)cyclopent-3-ene-1-carboxylate.
| Compound Name | methyl 3-(benzenesulfonyl)cyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 14108399 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | methyl 3-(benzenesulfonyl)cyclopent-3-ene-1-carboxylate |
| SMILES | COC(=O)C1CC=C(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C13H14O4S/c1-17-13(14)10-7-8-12(9-10)18(15,16)11-5-3-2-4-6-11/h2-6,8,10H,7,9H2,1H3 |
| InChIKey | QCOGJOMMXSNXIM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |