C20H18O4S2 — CID 22298015
2,5-bis(benzenesulfonyl)-1,3a,4,6a-tetrahydropentalene (PubChem CID 22298015) has the molecular formula C20H18O4S2 and a molecular weight of 386.49 g/mol. Its IUPAC name is 2,5-bis(benzenesulfonyl)-1,3a,4,6a-tetrahydropentalene.
| Compound Name | 2,5-bis(benzenesulfonyl)-1,3a,4,6a-tetrahydropentalene |
|---|---|
| PubChem CID | 22298015 |
| Molecular Formula | C20H18O4S2 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 2,5-bis(benzenesulfonyl)-1,3a,4,6a-tetrahydropentalene |
| SMILES | O=S(=O)(C1=CC2CC(S(=O)(=O)c3ccccc3)=CC2C1)c1ccccc1 |
| InChI | InChI=1S/C20H18O4S2/c21-25(22,17-7-3-1-4-8-17)19-11-15-13-20(14-16(15)12-19)26(23,24)18-9-5-2-6-10-18/h1-11,14-16H,12-13H2 |
| InChIKey | VKTJWUJBUSJVHI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |