C14H14O4S — CID 10891180
2-[5-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]acetic acid (PubChem CID 10891180) has the molecular formula C14H14O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-[5-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]acetic acid.
| Compound Name | 2-[5-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]acetic acid |
|---|---|
| PubChem CID | 10891180 |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-[5-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]acetic acid |
| SMILES | O=C(O)CC1C=CC=C(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C14H14O4S/c15-14(16)10-11-5-4-8-13(9-11)19(17,18)12-6-2-1-3-7-12/h1-8,11H,9-10H2,(H,15,16) |
| InChIKey | SXCXDMWKOVSPCL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |