C14H14O5S — CID 11323859
[(1R)-3-(benzenesulfonyl)-4-oxocyclopent-2-en-1-yl]methyl acetate (PubChem CID 11323859) has the molecular formula C14H14O5S and a molecular weight of 294.33 g/mol. Its IUPAC name is [(1R)-3-(benzenesulfonyl)-4-oxocyclopent-2-en-1-yl]methyl acetate.
| Compound Name | [(1R)-3-(benzenesulfonyl)-4-oxocyclopent-2-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 11323859 |
| Molecular Formula | C14H14O5S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | [(1R)-3-(benzenesulfonyl)-4-oxocyclopent-2-en-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C=C(S(=O)(=O)c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C14H14O5S/c1-10(15)19-9-11-7-13(16)14(8-11)20(17,18)12-5-3-2-4-6-12/h2-6,8,11H,7,9H2,1H3/t11-/m1/s1 |
| InChIKey | UJLMWAPXQLUTEA-LLVKDONJSA-N |
| XLogP | 1.50 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |