C16H16O3 — CID 102245159
[(3S,6R)-6-(2-phenylethynyl)-3,6-dihydro-2H-pyran-3-yl]methyl acetate (PubChem CID 102245159) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is [(3S,6R)-6-(2-phenylethynyl)-3,6-dihydro-2H-pyran-3-yl]methyl acetate.
| Compound Name | [(3S,6R)-6-(2-phenylethynyl)-3,6-dihydro-2H-pyran-3-yl]methyl acetate |
|---|---|
| PubChem CID | 102245159 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | [(3S,6R)-6-(2-phenylethynyl)-3,6-dihydro-2H-pyran-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C=C[C@H](C#Cc2ccccc2)OC1 |
| InChI | InChI=1S/C16H16O3/c1-13(17)18-11-15-8-10-16(19-12-15)9-7-14-5-3-2-4-6-14/h2-6,8,10,15-16H,11-12H2,1H3/t15-,16+/m1/s1 |
| InChIKey | ZZTMTLNWMLATIG-CVEARBPZSA-N |
| XLogP | 2.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|