C15H14O3S — CID 10869489
[(3S,6R)-6-(2-phenylsulfanylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 10869489) has the molecular formula C15H14O3S and a molecular weight of 274.34 g/mol. Its IUPAC name is [(3S,6R)-6-(2-phenylsulfanylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(3S,6R)-6-(2-phenylsulfanylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 10869489 |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | [(3S,6R)-6-(2-phenylsulfanylethynyl)-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@H](C#CSc2ccccc2)OC1 |
| InChI | InChI=1S/C15H14O3S/c1-12(16)18-14-8-7-13(17-11-14)9-10-19-15-5-3-2-4-6-15/h2-8,13-14H,11H2,1H3/t13-,14+/m1/s1 |
| InChIKey | KJVJPTDRODUXDQ-KGLIPLIRSA-N |
| XLogP | 2.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|