C16H16O4S — CID 101038651
[(2S,6R)-5-hydroxy-6-(2-phenylsulfanylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 101038651) has the molecular formula C16H16O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is [(2S,6R)-5-hydroxy-6-(2-phenylsulfanylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2S,6R)-5-hydroxy-6-(2-phenylsulfanylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101038651 |
| Molecular Formula | C16H16O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | [(2S,6R)-5-hydroxy-6-(2-phenylsulfanylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CC=C(O)[C@@H](C#CSc2ccccc2)O1 |
| InChI | InChI=1S/C16H16O4S/c1-12(17)19-11-13-7-8-15(18)16(20-13)9-10-21-14-5-3-2-4-6-14/h2-6,8,13,16,18H,7,11H2,1H3/t13-,16+/m0/s1 |
| InChIKey | GIJFGWJLVBVCJV-XJKSGUPXSA-N |
| XLogP | 2.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|