C14H18O6 — CID 123206550
[4,5-dihydroxy-6-(4-hydroxyphenyl)oxan-2-yl]methyl acetate (PubChem CID 123206550) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is [4,5-dihydroxy-6-(4-hydroxyphenyl)oxan-2-yl]methyl acetate.
| Compound Name | [4,5-dihydroxy-6-(4-hydroxyphenyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 123206550 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [4,5-dihydroxy-6-(4-hydroxyphenyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1CC(O)C(O)C(c2ccc(O)cc2)O1 |
| InChI | InChI=1S/C14H18O6/c1-8(15)19-7-11-6-12(17)13(18)14(20-11)9-2-4-10(16)5-3-9/h2-5,11-14,16-18H,6-7H2,1H3 |
| InChIKey | XNOVBPSZKJRMDN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |