C17H24O7 — CID 123453865
methyl 4-[4-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]phenoxy]butanoate (PubChem CID 123453865) has the molecular formula C17H24O7 and a molecular weight of 340.37 g/mol. Its IUPAC name is methyl 4-[4-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]phenoxy]butanoate.
| Compound Name | methyl 4-[4-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]phenoxy]butanoate |
|---|---|
| PubChem CID | 123453865 |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | methyl 4-[4-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1ccc(C2OC(CO)CC(O)C2O)cc1 |
| InChI | InChI=1S/C17H24O7/c1-22-15(20)3-2-8-23-12-6-4-11(5-7-12)17-16(21)14(19)9-13(10-18)24-17/h4-7,13-14,16-19,21H,2-3,8-10H2,1H3 |
| InChIKey | LQIPEHKIZXNKFX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|