About methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate
methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate (PubChem CID 123585133) has the molecular formula C21H24O8
and a molecular weight of 404.42 g/mol. Its IUPAC name is methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate.
Molecular Properties
| Compound Name | methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate |
| PubChem CID | 123585133 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate |
| SMILES | COC(=O)c1ccc(Oc2cc(C3OC(CO)CC(O)C3O)ccc2OC)cc1 |
| InChI | InChI=1S/C21H24O8/c1-26-17-8-5-13(20-19(24)16(23)10-15(11-22)29-20)9-18(17)28-14-6-3-12(4-7-14)21(25)27-2/h3-9,15-16,19-20,22-24H,10-11H2,1-2H3 |
| InChIKey | JNRHMSLEVWTQFY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate?
The IUPAC name of methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate (CID 123585133) is methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate.
What is the SMILES notation for methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate?
The canonical SMILES for methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate is COC(=O)c1ccc(Oc2cc(C3OC(CO)CC(O)C3O)ccc2OC)cc1.
What is the InChIKey of methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate?
The InChIKey is JNRHMSLEVWTQFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O8/c1-26-17-8-5-13(20-19(24)16(23)10-15(11-22)29-20)9-18(17)28-14-6-3-12(4-7-14)21(25)27-2/h3-9,15-16,19-20,22-24H,10-11H2,1-2H3.
What are the key properties of methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate?
methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate has a molecular weight of 404.42 g/mol, XLogP of 1.82, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[5-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-methoxyphenoxy]benzoate is sourced from PubChem (CID 123585133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).