C17H24O5 — CID 125485988
[(2S,5S)-5-(2-phenylmethoxyethoxymethyl)oxolan-2-yl]methyl acetate (PubChem CID 125485988) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [(2S,5S)-5-(2-phenylmethoxyethoxymethyl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,5S)-5-(2-phenylmethoxyethoxymethyl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 125485988 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(2S,5S)-5-(2-phenylmethoxyethoxymethyl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CC[C@@H](COCCOCc2ccccc2)O1 |
| InChI | InChI=1S/C17H24O5/c1-14(18)21-13-17-8-7-16(22-17)12-20-10-9-19-11-15-5-3-2-4-6-15/h2-6,16-17H,7-13H2,1H3/t16-,17-/m0/s1 |
| InChIKey | PJLNFRROJLAJOI-IRXDYDNUSA-N |
| XLogP | 2.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|