C15H20O5 — CID 93493280
[(2R,6S)-6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate (PubChem CID 93493280) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is [(2R,6S)-6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate.
| Compound Name | [(2R,6S)-6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 93493280 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | [(2R,6S)-6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1COC[C@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C15H20O5/c1-12(16)19-11-15-10-18-9-14(20-15)8-17-7-13-5-3-2-4-6-13/h2-6,14-15H,7-11H2,1H3/t14-,15+/m0/s1 |
| InChIKey | VJMAITQRABEEKP-LSDHHAIUSA-N |
| XLogP | 1.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |