C14H16O3 — CID 155075905
[(2S,6S)-6-phenyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 155075905) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is [(2S,6S)-6-phenyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2S,6S)-6-phenyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155075905 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | [(2S,6S)-6-phenyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CC=C[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C14H16O3/c1-11(15)16-10-13-8-5-9-14(17-13)12-6-3-2-4-7-12/h2-7,9,13-14H,8,10H2,1H3/t13-,14-/m0/s1 |
| InChIKey | GXVUQGFEVVJRIG-KBPBESRZSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|