About (2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methyl acetate
(2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methyl acetate (PubChem CID 163623507) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is (2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methyl acetate.
Analyze (2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methyl acetate?
The IUPAC name of (2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methyl acetate (CID 163623507) is (2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methyl acetate.
What is the SMILES notation for (2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methyl acetate?
The canonical SMILES for (2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methyl acetate is CC(=O)OCC1N=C(C)OC1c1ccccc1.
What is the InChIKey of (2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methyl acetate?
The InChIKey is HQDOPWULKGUJDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-9-14-12(8-16-10(2)15)13(17-9)11-6-4-3-5-7-11/h3-7,12-13H,8H2,1-2H3.
What are the key properties of (2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methyl acetate?
(2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methyl acetate has a molecular weight of 233.27 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)methyl acetate is sourced from PubChem (CID 163623507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).