C19H19NO3 — CID 101115518
(4S,5S)-4-(methoxymethyl)-5-phenyl-2-(3-phenyloxiran-2-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 101115518) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (4S,5S)-4-(methoxymethyl)-5-phenyl-2-(3-phenyloxiran-2-yl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5S)-4-(methoxymethyl)-5-phenyl-2-(3-phenyloxiran-2-yl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 101115518 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (4S,5S)-4-(methoxymethyl)-5-phenyl-2-(3-phenyloxiran-2-yl)-4,5-dihydro-1,3-oxazole |
| SMILES | COC[C@@H]1N=C(C2OC2c2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H19NO3/c1-21-12-15-16(13-8-4-2-5-9-13)23-19(20-15)18-17(22-18)14-10-6-3-7-11-14/h2-11,15-18H,12H2,1H3/t15-,16-,17?,18?/m0/s1 |
| InChIKey | KUWVAGWDWBSPFQ-VYMRPNJYSA-N |
| XLogP | 3.31 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|