C13H18O4 — CID 14265871
(4S,5S)-4,5-bis(methoxymethyl)-2-phenyl-1,3-dioxolane (PubChem CID 14265871) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (4S,5S)-4,5-bis(methoxymethyl)-2-phenyl-1,3-dioxolane.
| Compound Name | (4S,5S)-4,5-bis(methoxymethyl)-2-phenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 14265871 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (4S,5S)-4,5-bis(methoxymethyl)-2-phenyl-1,3-dioxolane |
| SMILES | COC[C@@H]1OC(c2ccccc2)O[C@H]1COC |
| InChI | InChI=1S/C13H18O4/c1-14-8-11-12(9-15-2)17-13(16-11)10-6-4-3-5-7-10/h3-7,11-13H,8-9H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | WHYBRKAEJAASKV-RYUDHWBXSA-N |
| XLogP | 1.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |