C11H14O2 — CID 68508640
(4S)-4,5-dimethyl-2-phenyl-1,3-dioxolane (PubChem CID 68508640) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (4S)-4,5-dimethyl-2-phenyl-1,3-dioxolane.
| Compound Name | (4S)-4,5-dimethyl-2-phenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 68508640 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (4S)-4,5-dimethyl-2-phenyl-1,3-dioxolane |
| SMILES | CC1OC(c2ccccc2)O[C@H]1C |
| InChI | InChI=1S/C11H14O2/c1-8-9(2)13-11(12-8)10-6-4-3-5-7-10/h3-9,11H,1-2H3/t8-,9?,11?/m0/s1 |
| InChIKey | KELZBYQXUNVXEU-SILCLGDVSA-N |
| XLogP | 2.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |