C13H16O4 — CID 11128285
(2R,4R,4aS,7aS)-4-methyl-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-6-ol (PubChem CID 11128285) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (2R,4R,4aS,7aS)-4-methyl-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-6-ol.
| Compound Name | (2R,4R,4aS,7aS)-4-methyl-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-6-ol |
|---|---|
| PubChem CID | 11128285 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (2R,4R,4aS,7aS)-4-methyl-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-6-ol |
| SMILES | C[C@H]1O[C@@H](c2ccccc2)O[C@H]2CC(O)O[C@H]21 |
| InChI | InChI=1S/C13H16O4/c1-8-12-10(7-11(14)17-12)16-13(15-8)9-5-3-2-4-6-9/h2-6,8,10-14H,7H2,1H3/t8-,10+,11?,12+,13-/m1/s1 |
| InChIKey | RQRZBZHYJAXYAW-KGBGXNQPSA-N |
| XLogP | 1.60 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |