C14H16O3 — CID 58388646
(8aS)-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-ol (PubChem CID 58388646) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is (8aS)-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-ol.
| Compound Name | (8aS)-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-ol |
|---|---|
| PubChem CID | 58388646 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (8aS)-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-ol |
| SMILES | OC1C=CC2COC(c3ccccc3)O[C@H]2C1 |
| InChI | InChI=1S/C14H16O3/c15-12-7-6-11-9-16-14(17-13(11)8-12)10-4-2-1-3-5-10/h1-7,11-15H,8-9H2/t11?,12?,13-,14?/m0/s1 |
| InChIKey | BSAZMBOWENCUCV-RFPFOJJUSA-N |
| XLogP | 2.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|