C14H16O4 — CID 11118405
(4aR,7S,8R,8aR)-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxine-7,8-diol (PubChem CID 11118405) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (4aR,7S,8R,8aR)-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxine-7,8-diol.
| Compound Name | (4aR,7S,8R,8aR)-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxine-7,8-diol |
|---|---|
| PubChem CID | 11118405 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (4aR,7S,8R,8aR)-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxine-7,8-diol |
| SMILES | O[C@H]1[C@@H]2OC(c3ccccc3)OC[C@H]2C=C[C@@H]1O |
| InChI | InChI=1S/C14H16O4/c15-11-7-6-10-8-17-14(18-13(10)12(11)16)9-4-2-1-3-5-9/h1-7,10-16H,8H2/t10-,11+,12-,13-,14?/m1/s1 |
| InChIKey | ZNRQRCYJSGBDKN-DYPLGBCKSA-N |
| XLogP | 1.01 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|