C16H18O5 — CID 10979135
[(4aR,7S,8S,8aR)-8-hydroxy-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-yl] acetate (PubChem CID 10979135) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is [(4aR,7S,8S,8aR)-8-hydroxy-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-yl] acetate.
| Compound Name | [(4aR,7S,8S,8aR)-8-hydroxy-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-yl] acetate |
|---|---|
| PubChem CID | 10979135 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [(4aR,7S,8S,8aR)-8-hydroxy-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C16H18O5/c1-10(17)20-13-8-7-12-9-19-16(21-15(12)14(13)18)11-5-3-2-4-6-11/h2-8,12-16,18H,9H2,1H3/t12-,13+,14-,15-,16?/m1/s1 |
| InChIKey | ATZBUCOUWAFJGG-KJAHXBPPSA-N |
| XLogP | 1.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|