C22H32O5Si — CID 11732215
[(4aR,7S,8S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-8-yl] acetate (PubChem CID 11732215) has the molecular formula C22H32O5Si and a molecular weight of 404.58 g/mol. Its IUPAC name is [(4aR,7S,8S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-8-yl] acetate.
| Compound Name | [(4aR,7S,8S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-8-yl] acetate |
|---|---|
| PubChem CID | 11732215 |
| Molecular Formula | C22H32O5Si |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [(4aR,7S,8S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2OC(c3ccccc3)OC[C@H]2C=C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H32O5Si/c1-15(23)25-20-18(27-28(5,6)22(2,3)4)13-12-17-14-24-21(26-19(17)20)16-10-8-7-9-11-16/h7-13,17-21H,14H2,1-6H3/t17-,18+,19-,20-,21?/m1/s1 |
| InChIKey | NHVRSAOXIJNQNE-YNBHDNDASA-N |
| XLogP | 4.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|