C31H36N2O6Si — CID 11049994
1-[(4aR,7R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-yl]-3-benzoylpyrimidine-2,4-dione (PubChem CID 11049994) has the molecular formula C31H36N2O6Si and a molecular weight of 560.72 g/mol. Its IUPAC name is 1-[(4aR,7R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-yl]-3-benzoylpyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,7R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-yl]-3-benzoylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11049994 |
| Molecular Formula | C31H36N2O6Si |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 1-[(4aR,7R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-yl]-3-benzoylpyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H]2OC(c3ccccc3)OC[C@H]2C=C[C@H]1n1ccc(=O)n(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C31H36N2O6Si/c1-31(2,3)40(4,5)39-27-24(17-16-23-20-37-29(38-26(23)27)22-14-10-7-11-15-22)32-19-18-25(34)33(30(32)36)28(35)21-12-8-6-9-13-21/h6-19,23-24,26-27,29H,20H2,1-5H3/t23-,24-,26-,27-,29?/m1/s1 |
| InChIKey | LIOIIBUZDCTRII-GMBOMQRZSA-N |
| XLogP | 4.93 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|