C23H34O5Si — CID 11373474
[(1S,2S,3S,6S,9R)-3-[tert-butyl(dimethyl)silyl]oxy-12-phenyl-8,11,13-trioxatricyclo[7.4.0.02,6]tridec-4-en-5-yl]methanol (PubChem CID 11373474) has the molecular formula C23H34O5Si and a molecular weight of 418.61 g/mol. Its IUPAC name is [(1S,2S,3S,6S,9R)-3-[tert-butyl(dimethyl)silyl]oxy-12-phenyl-8,11,13-trioxatricyclo[7.4.0.02,6]tridec-4-en-5-yl]methanol.
| Compound Name | [(1S,2S,3S,6S,9R)-3-[tert-butyl(dimethyl)silyl]oxy-12-phenyl-8,11,13-trioxatricyclo[7.4.0.02,6]tridec-4-en-5-yl]methanol |
|---|---|
| PubChem CID | 11373474 |
| Molecular Formula | C23H34O5Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | [(1S,2S,3S,6S,9R)-3-[tert-butyl(dimethyl)silyl]oxy-12-phenyl-8,11,13-trioxatricyclo[7.4.0.02,6]tridec-4-en-5-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C(CO)[C@H]2CO[C@@H]3COC(c4ccccc4)O[C@H]3[C@@H]12 |
| InChI | InChI=1S/C23H34O5Si/c1-23(2,3)29(4,5)28-18-11-16(12-24)17-13-25-19-14-26-22(27-21(19)20(17)18)15-9-7-6-8-10-15/h6-11,17-22,24H,12-14H2,1-5H3/t17-,18+,19-,20-,21-,22?/m1/s1 |
| InChIKey | AIXRCEALWDYGSF-YGLZHXLNSA-N |
| XLogP | 4.05 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|