C18H22O4 — CID 101339591
[(4aS,7S,8aR)-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-yl] butanoate (PubChem CID 101339591) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(4aS,7S,8aR)-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-yl] butanoate.
| Compound Name | [(4aS,7S,8aR)-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-yl] butanoate |
|---|---|
| PubChem CID | 101339591 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(4aS,7S,8aR)-2-phenyl-4a,7,8,8a-tetrahydro-4H-1,3-benzodioxin-7-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1C=C[C@H]2COC(c3ccccc3)O[C@@H]2C1 |
| InChI | InChI=1S/C18H22O4/c1-2-6-17(19)21-15-10-9-14-12-20-18(22-16(14)11-15)13-7-4-3-5-8-13/h3-5,7-10,14-16,18H,2,6,11-12H2,1H3/t14-,15+,16+,18?/m0/s1 |
| InChIKey | KHQQEWOTJAPUSV-AGLYMACPSA-N |
| XLogP | 3.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|