C26H29IO7 — CID 11135628
[(2R,4aR,6S,7R,8S,8aR)-6-(4-iodophenoxy)-2-phenyl-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] butanoate (PubChem CID 11135628) has the molecular formula C26H29IO7 and a molecular weight of 580.42 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8S,8aR)-6-(4-iodophenoxy)-2-phenyl-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] butanoate.
| Compound Name | [(2R,4aR,6S,7R,8S,8aR)-6-(4-iodophenoxy)-2-phenyl-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] butanoate |
|---|---|
| PubChem CID | 11135628 |
| Molecular Formula | C26H29IO7 |
| Molecular Weight | 580.42 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | [(2R,4aR,6S,7R,8S,8aR)-6-(4-iodophenoxy)-2-phenyl-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] butanoate |
| SMILES | C=CCO[C@@H]1[C@@H](OC(=O)CCC)[C@H](Oc2ccc(I)cc2)O[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C26H29IO7/c1-3-8-21(28)33-24-23(29-15-4-2)22-20(16-30-25(34-22)17-9-6-5-7-10-17)32-26(24)31-19-13-11-18(27)12-14-19/h4-7,9-14,20,22-26H,2-3,8,15-16H2,1H3/t20-,22-,23+,24-,25-,26-/m1/s1 |
| InChIKey | HNLDXVQOVBUHHC-KBBOSMITSA-N |
| XLogP | 4.79 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|