C21H28O6S — CID 10740222
(2R,4aR,6R,7S,8S,8aR)-6-ethylsulfinyl-2-phenyl-7,8-bis(prop-2-enoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 10740222) has the molecular formula C21H28O6S and a molecular weight of 408.52 g/mol. Its IUPAC name is (2R,4aR,6R,7S,8S,8aR)-6-ethylsulfinyl-2-phenyl-7,8-bis(prop-2-enoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6R,7S,8S,8aR)-6-ethylsulfinyl-2-phenyl-7,8-bis(prop-2-enoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 10740222 |
| Molecular Formula | C21H28O6S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (2R,4aR,6R,7S,8S,8aR)-6-ethylsulfinyl-2-phenyl-7,8-bis(prop-2-enoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | C=CCO[C@H]1[C@@H]2O[C@H](c3ccccc3)OC[C@H]2O[C@H](S(=O)CC)[C@H]1OCC=C |
| InChI | InChI=1S/C21H28O6S/c1-4-12-23-18-17-16(14-25-20(27-17)15-10-8-7-9-11-15)26-21(28(22)6-3)19(18)24-13-5-2/h4-5,7-11,16-21H,1-2,6,12-14H2,3H3/t16-,17-,18+,19+,20-,21-,28?/m1/s1 |
| InChIKey | QVZBHZVJIPBALJ-ZTUUKUKESA-N |
| XLogP | 2.74 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|