C16H19NO4 — CID 101491608
(1S,2S,4R,5S,7R)-10-phenyl-5-prop-2-enoxy-6,9,11-trioxa-3-azatricyclo[5.4.0.02,4]undecane (PubChem CID 101491608) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (1S,2S,4R,5S,7R)-10-phenyl-5-prop-2-enoxy-6,9,11-trioxa-3-azatricyclo[5.4.0.02,4]undecane.
| Compound Name | (1S,2S,4R,5S,7R)-10-phenyl-5-prop-2-enoxy-6,9,11-trioxa-3-azatricyclo[5.4.0.02,4]undecane |
|---|---|
| PubChem CID | 101491608 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (1S,2S,4R,5S,7R)-10-phenyl-5-prop-2-enoxy-6,9,11-trioxa-3-azatricyclo[5.4.0.02,4]undecane |
| SMILES | C=CCO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H]2N[C@@H]12 |
| InChI | InChI=1S/C16H19NO4/c1-2-8-18-16-13-12(17-13)14-11(20-16)9-19-15(21-14)10-6-4-3-5-7-10/h2-7,11-17H,1,8-9H2/t11-,12+,13-,14-,15?,16+/m1/s1 |
| InChIKey | GMOHRWGVVBYTKL-YLUFJFMLSA-N |
| XLogP | 1.37 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|