C17H24O10S3 — CID 139191929
[(2R,4aR,6S,7R,8S,8aR)-6-[(R)-ethylsulfinyl]-7-methylsulfonyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate (PubChem CID 139191929) has the molecular formula C17H24O10S3 and a molecular weight of 484.57 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8S,8aR)-6-[(R)-ethylsulfinyl]-7-methylsulfonyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate.
| Compound Name | [(2R,4aR,6S,7R,8S,8aR)-6-[(R)-ethylsulfinyl]-7-methylsulfonyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate |
|---|---|
| PubChem CID | 139191929 |
| Molecular Formula | C17H24O10S3 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | [(2R,4aR,6S,7R,8S,8aR)-6-[(R)-ethylsulfinyl]-7-methylsulfonyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate |
| SMILES | CC[S@@](=O)[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OS(C)(=O)=O)[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C17H24O10S3/c1-4-28(18)17-15(27-30(3,21)22)14(26-29(2,19)20)13-12(24-17)10-23-16(25-13)11-8-6-5-7-9-11/h5-9,12-17H,4,10H2,1-3H3/t12-,13-,14+,15-,16-,17+,28-/m1/s1 |
| InChIKey | KGKXCKWJPOKCBQ-IYODXVTGSA-N |
| XLogP | 0.28 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|