C27H28O5S — CID 21054106
6-(benzenesulfinyl)-7-methyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 21054106) has the molecular formula C27H28O5S and a molecular weight of 464.58 g/mol. Its IUPAC name is 6-(benzenesulfinyl)-7-methyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | 6-(benzenesulfinyl)-7-methyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 21054106 |
| Molecular Formula | C27H28O5S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 6-(benzenesulfinyl)-7-methyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CC1C(OCc2ccccc2)C2OC(c3ccccc3)OCC2OC1S(=O)c1ccccc1 |
| InChI | InChI=1S/C27H28O5S/c1-19-24(29-17-20-11-5-2-6-12-20)25-23(18-30-26(32-25)21-13-7-3-8-14-21)31-27(19)33(28)22-15-9-4-10-16-22/h2-16,19,23-27H,17-18H2,1H3 |
| InChIKey | DZCJMRLAPJNVQS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |