C33H42O7SSi — CID 11767246
[(2R,4aR,6R,7S,8S,8aR)-6-(benzenesulfinyl)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11767246) has the molecular formula C33H42O7SSi and a molecular weight of 610.85 g/mol. Its IUPAC name is [(2R,4aR,6R,7S,8S,8aR)-6-(benzenesulfinyl)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,4aR,6R,7S,8S,8aR)-6-(benzenesulfinyl)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11767246 |
| Molecular Formula | C33H42O7SSi |
| Molecular Weight | 610.85 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | [(2R,4aR,6R,7S,8S,8aR)-6-(benzenesulfinyl)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COc1ccc(CO[C@H]2[C@@H]3O[C@H](c4ccccc4)OC[C@H]3O[C@H](S(=O)c3ccccc3)[C@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H42O7SSi/c1-33(2,3)42(5,6)40-30-29(36-21-23-17-19-25(35-4)20-18-23)28-27(22-37-31(39-28)24-13-9-7-10-14-24)38-32(30)41(34)26-15-11-8-12-16-26/h7-20,27-32H,21-22H2,1-6H3/t27-,28-,29+,30+,31-,32-,41?/m1/s1 |
| InChIKey | KAVQNOYDJIHZSW-HCQIWOKWSA-N |
| XLogP | 6.62 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.85 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|